MPC 5-chloro-1,2-dihydro-4-methoxy-2-oxo-3-pyridinecarbonitrile - Names and Identifiers
Name | 5-CHLORO-1,2-DIHYDRO-4-METHOXY-2-OXO-3-PYRIDINECARBONITRILE
|
Synonyms | 3-Cyano GiMeracil Methyl Ether 5-Chloro-3-cyano-4-methoxy-2(1H)-pyridone 5-Chloro-3-Cyano-4-methony-2-(1H)-pyridinone 5-Chloro-4-Methoxy-2-oxo-1,2-dihydropyridine-3-carbonitrile 3-pyridinecarbonitrile, 5-chloro-1,2-dihydro-4-methoxy-2-ox 5-Chloro-4-methoxy-2-oxo-1,2-dihydropyridine-3-carbonitrile 5-CHLORO-1,2-DIHYDRO-4-METHOXY-2-OXO-3-PYRIDINECARBONITRILE 3-pyridinecarbonitrile, 5-chloro-1,2-dihydro-4-methoxy-2-oxo- MPC 5-chloro-1,2-dihydro-4-methoxy-2-oxo-3-pyridinecarbonitrile
|
CAS | 147619-40-7
|
InChI | InChI=1/C7H5ClN2O2/c1-12-6-4(2-9)7(11)10-3-5(6)8/h3H,1H3,(H,10,11) |
MPC 5-chloro-1,2-dihydro-4-methoxy-2-oxo-3-pyridinecarbonitrile - Physico-chemical Properties
Molecular Formula | C7H5ClN2O2
|
Molar Mass | 184.58 |
Density | 1.43±0.1 g/cm3(Predicted) |
Boling Point | 376.8±42.0 °C(Predicted) |
Flash Point | 181.709°C |
Solubility | Dimethyl Sulfoxide, Methanol |
Vapor Presure | 0mmHg at 25°C |
Appearance | Solid |
Color | Light Yellow |
pKa | 5.93±0.10(Predicted) |
Storage Condition | 2-8°C |
Refractive Index | 1.563 |
MPC 5-chloro-1,2-dihydro-4-methoxy-2-oxo-3-pyridinecarbonitrile - Introduction
5-chroo-1 is an organic compound with the chemical formula C9H6ClNO2. The following is a description of the properties, uses, preparation and safety information of the compound:
1. Nature:
-Appearance: 5-chroo-1, white crystal powder.
-Melting point: about 130-135 degrees Celsius.
-Solubility: It has a certain solubility and can be dissolved in some polar solvents, such as ethanol and dimethylformamide.
2. Use:
-As a pesticide intermediate: 5-chroo-1, it can be used as an intermediate for synthetic pesticides, such as pyridone pesticides.
-Pharmaceutical field: The compound also has certain research and application value in the pharmaceutical field.
3. Preparation method:
-the synthesis path is more complex, commonly used synthetic methods include: 4-amino -2-methoxypyridine as the starting material, after a series of chemical reactions, such as hydrogenation, substitution, reactions such as oxidation give the target compound.
4. Safety Information:
- 5-CHLORO-1, belonging to organochlorine compounds, has certain toxicity. Pay attention to safety measures during use and operation, and wear appropriate protective equipment, such as protective gloves and goggles.
-Avoid direct contact with skin, eyes and respiratory tract, and maintain good ventilation.
-During storage and disposal, relevant laws and regulations should be observed to prevent pollution to the environment.
Last Update:2024-04-09 02:00:42